CAS 83949-40-0

1-(3-Methoxyphenyl)-2-methylpiperazine

Description:

1-(3-Methoxyphenyl)-2-methylpiperazine is an organic compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a methoxyphenyl group at the first position and a methyl group at the second position of the piperazine ring. It is typically a white to off-white solid and is soluble in organic solvents, reflecting its moderate polarity due to the presence of both hydrophobic and hydrophilic groups. The methoxy group enhances its lipophilicity, potentially influencing its biological activity. This compound is of interest in medicinal chemistry, particularly for its potential pharmacological properties, including effects on the central nervous system. Its structure allows for interactions with various neurotransmitter systems, making it a candidate for research in areas such as anxiety, depression, and other neuropsychiatric disorders. As with many piperazine derivatives, it may exhibit a range of biological activities, necessitating further investigation to fully understand its therapeutic potential and safety profile.

Formula: C₁₂H₁₈N₂O

InChI: InChI=1S/C12H18N2O/c1-10-9-13-6-7-14(10)11-4-3-5-12(8-11)15-2/h3-5,8,10,13H,6-7,9H2,1-2H3

InChI key: InChIKey=VIUHJEYRGSUXOI-UHFFFAOYSA-N

SMILES: CC1N(C2=CC(OC)=CC=C2)CCNC1

Synonyms:

• Piperazine, 1-(3-methoxyphenyl)-2-methyl-
• 1-(3-Methoxyphenyl)-2-methylpiperazine