
CAS 83949-41-1
:4-(Phenylamino)-4-piperidinemethanamine
Description:
4-(Phenylamino)-4-piperidinemethanamine, also known by its CAS number 83949-41-1, is a chemical compound characterized by its piperidine structure, which includes a phenylamino group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds due to the presence of nitrogen atoms. It is likely to be a solid at room temperature and may have moderate solubility in polar solvents, depending on its specific functional groups and molecular interactions. The presence of the phenyl group can contribute to its hydrophobic characteristics, while the piperidine ring may influence its reactivity and interaction with biological systems. Compounds like this are often studied for their potential applications in pharmaceuticals, particularly in the development of drugs targeting the central nervous system or other therapeutic areas. Safety data and handling precautions should be considered, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C12H19N3
InChI:InChI=1S/C12H19N3/c13-10-12(6-8-14-9-7-12)15-11-4-2-1-3-5-11/h1-5,14-15H,6-10,13H2
InChI key:InChIKey=ZTXCELVEIDRPHK-UHFFFAOYSA-N
SMILES:N(C1(CN)CCNCC1)C2=CC=CC=C2
Synonyms:- 4-(Phenylamino)-4-piperidinemethanamine
- 4-Piperidinemethanamine, 4-(phenylamino)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.