CymitQuimica logo

CAS 83961-56-2

:

ethyl 4,4,4-trifluoro-2-(triphenyl-phosphoranylid

Description:
Ethyl 4,4,4-trifluoro-2-(triphenylphosphoranylidene)acetate, identified by CAS number 83961-56-2, is an organophosphorus compound characterized by the presence of a phosphoranylidene group attached to a trifluorinated ethyl acetate moiety. This compound typically exhibits a high degree of reactivity due to the electron-withdrawing effects of the trifluoromethyl groups, which can influence its chemical behavior in various reactions, particularly in nucleophilic substitutions and coupling reactions. The triphenylphosphoranylidene moiety contributes to its stability and can facilitate the formation of intermediates in organic synthesis. Additionally, the presence of fluorine atoms often imparts unique physical properties, such as increased lipophilicity and altered boiling and melting points compared to non-fluorinated analogs. Ethyl 4,4,4-trifluoro-2-(triphenylphosphoranylidene)acetate is of interest in synthetic organic chemistry, particularly in the development of new methodologies for the construction of complex molecules. Its applications may extend to pharmaceuticals and agrochemicals, where fluorinated compounds are often sought for their enhanced biological activity.
Formula:C24H20F3O3P
InChI:InChI=1/C24H20F3O3P/c1-2-30-23(29)21(22(28)24(25,26)27)31(18-12-6-3-7-13-18,19-14-8-4-9-15-19)20-16-10-5-11-17-20/h3-17H,2H2,1H3
SMILES:CCOC(=O)C(=P(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)C(F)(F)F
Synonyms:
  • Ethyl 4,4,4-trifluoro-2-(triphenylphosphoranylidene)acetoacetate
  • Ethyl 4,4,4-Trifluoro-3-Oxo-2-(Triphenyl-Lambda~5~-Phosphanylidene)Butanoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.