CAS 839713-36-9
:N-[3-(4-Bromo-1-methyl-1H-pyrazol-5-yl)-4-methoxyphenyl]-N′-(2,4-difluorophenyl)urea
Description:
N-[3-(4-Bromo-1-methyl-1H-pyrazol-5-yl)-4-methoxyphenyl]-N′-(2,4-difluorophenyl)urea, with CAS number 839713-36-9, is a synthetic organic compound characterized by its complex molecular structure, which includes a urea functional group linked to two distinct aromatic moieties. The presence of a bromine atom and difluorophenyl groups contributes to its potential biological activity, making it of interest in pharmaceutical research. The compound's pyrazole ring and methoxy substitution enhance its chemical reactivity and solubility properties. Typically, such compounds are evaluated for their efficacy in various biological assays, particularly in the context of drug development. The molecular interactions, including hydrogen bonding and π-π stacking, play a crucial role in its biological activity. Additionally, the compound's stability, solubility, and reactivity can be influenced by the presence of halogen substituents, which may affect its pharmacokinetic properties. Overall, this compound represents a class of molecules that may exhibit significant therapeutic potential, warranting further investigation in medicinal chemistry.
Formula:C18H15BrF2N4O2
InChI:InChI=1S/C18H15BrF2N4O2/c1-25-17(13(19)9-22-25)12-8-11(4-6-16(12)27-2)23-18(26)24-15-5-3-10(20)7-14(15)21/h3-9H,1-2H3,(H2,23,24,26)
InChI key:InChIKey=COSPVUFTLGQDQL-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=C(NC(NC2=C(F)C=C(F)C=C2)=O)C=C1)C3=C(Br)C=NN3C
Synonyms:- 1-[3-(4-Bromo-2-methyl-2H-pyrazol-3-yl)-4-methoxyphenyl]-3-(2,4-difluorophenyl)urea
- APD 125
- N-[3-(4-Bromo-1-methyl-1H-pyrazol-5-yl)-4-methoxyphenyl]-N′-(2,4-difluorophenyl)urea
- 1-(2,4-Difluorophenyl)-3-[4-methoxy-3-(4-bromo-1-methyl-1H-pyrazol-5-yl)phenyl]urea
- Urea, N-[3-(4-bromo-1-methyl-1H-pyrazol-5-yl)-4-methoxyphenyl]-N′-(2,4-difluorophenyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-[3-(4-Bromo-1-methyl-1H-pyrazol-5-yl)-4-methoxyphenyl]-3-(2,4-difluorophenyl)urea
CAS:Formula:C18H15BrF2N4O2Purity:98%Color and Shape:SolidMolecular weight:437.23811-(3-(4-Bromo-1-Methyl-1H-Pyrazol-5-Yl)-4-Methoxyphenyl)-3-(2,4-Difluorophenyl)Urea
CAS:1-(3-(4-Bromo-1-Methyl-1H-Pyrazol-5-Yl)-4-Methoxyphenyl)-3-(2,4-Difluorophenyl)UreaPurity:99%Molecular weight:437.24g/molNelotanserin
CAS:Nelotanserin (APD125): strong 5-HT2A inverse agonist (IC50: 1.7 nM), moderate 5-HT2C (79 nM), weak 5-HT2B (791 nM).Formula:C18H15BrF2N4O2Purity:98.42% - 99.88%Color and Shape:SolidMolecular weight:437.24Ref: TM-T7350
1mg38.00€2mg50.00€1mL*10mM (DMSO)80.00€5mg84.00€10mg113.00€25mg178.00€50mg333.00€100mg495.00€500mg1,071.00€Nelotanserin
CAS:1-[3-(4-Bromo-1-methyl-1H-pyrazol-5-yl)-4-methoxyphenyl]-3-(2,4-difluorophenyl)urea is the active ingredient in a drug that is used to treat chronic schizophrenia. It has been shown to have both antipsychotic and antidepressant properties. The drug works by blocking the 5HT2A receptor, which inhibits the effects of serotonin on heterocyclic amines at the postsynaptic membrane. This causes hyperpolarization of the membrane, which blocks neurotransmitter release and prevents further transmission of signals. It also blocks the H1 receptor, which decreases histamine release and reduces inflammation in the brain.Formula:C18H15BrF2N4O2Purity:Min. 95%Color and Shape:PowderMolecular weight:437.24 g/mol



