CAS 83982-78-9
:4-methyl-5-[4-(methylsulfinyl)benzoyl]-1,3-dihydro-2H-imidazol-2-one
Description:
4-methyl-5-[4-(methylsulfinyl)benzoyl]-1,3-dihydro-2H-imidazol-2-one is a chemical compound characterized by its unique structure, which includes an imidazole ring, a methyl group, and a benzoyl moiety with a methylsulfinyl substituent. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the methylsulfinyl group may impart specific reactivity and influence its pharmacological properties, making it of interest in medicinal chemistry. The imidazole ring is known for its role in various biological systems, often contributing to the compound's ability to interact with biological targets. Additionally, the compound's molecular structure suggests potential applications in drug development, particularly in areas related to anti-inflammatory or antimicrobial activities. Its CAS number, 83982-78-9, allows for easy identification and reference in chemical databases, facilitating research and development efforts. Overall, this compound represents a class of molecules that may hold promise in therapeutic applications.
Formula:C12H12N2O3S
InChI:InChI=1/C12H12N2O3S/c1-7-10(14-12(16)13-7)11(15)8-3-5-9(6-4-8)18(2)17/h3-6H,1-2H3,(H2,13,14,16)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Enoximone sulfoxide
CAS:Enoximone sulfoxide is a PDE3 inhibitor used for congestive heart failure; it boosts heart contractility and dilates vessels without affecting oxygen use.Formula:C12H12N2O3SColor and Shape:SolidMolecular weight:264.3
