CymitQuimica logo

CAS 83987-53-5

:

4-(Methylthio)benzenepropanamine

Description:
4-(Methylthio)benzenepropanamine, with the CAS number 83987-53-5, is an organic compound characterized by the presence of a propanamine group attached to a benzene ring that has a methylthio substituent. This compound features a sulfur atom in the form of a methylthio group (-S-CH3), which can influence its chemical reactivity and properties. The presence of the amine functional group (-NH2) suggests that it can participate in hydrogen bonding, making it potentially soluble in polar solvents. The methylthio group may also impart unique electronic properties, affecting the compound's reactivity in various chemical reactions. Additionally, the structure indicates that it may exhibit biological activity, as many amines and thioethers are known to interact with biological systems. Overall, 4-(Methylthio)benzenepropanamine is a compound of interest in both synthetic organic chemistry and potential pharmaceutical applications, although specific data regarding its physical properties, reactivity, and biological effects would require further investigation.
Formula:C10H15NS
InChI:InChI=1S/C10H15NS/c1-12-10-6-4-9(5-7-10)3-2-8-11/h4-7H,2-3,8,11H2,1H3
InChI key:InChIKey=KZVIAMZAFLNPIN-UHFFFAOYSA-N
SMILES:C(CCN)C1=CC=C(SC)C=C1
Synonyms:
  • 3-(4-(Methylthio)phenyl)-1-propanamine
  • 4-(Methylthio)benzenepropanamine
  • Benzenepropanamine, 4-(methylthio)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.