CymitQuimica logo

CAS 83988-31-2

:

4-Amino-3-methyl-5-isoxazolecarboxylic acid

Description:
4-Amino-3-methyl-5-isoxazolecarboxylic acid, with the CAS number 83988-31-2, is an organic compound characterized by its isoxazole ring structure, which contributes to its unique chemical properties. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH), making it an amino acid derivative. It is typically a white to off-white solid that is soluble in water, reflecting its polar functional groups. The presence of the isoxazole ring imparts specific reactivity and stability, often making it of interest in pharmaceutical and biochemical research. This compound may exhibit biological activity, potentially influencing various metabolic pathways. Its structural characteristics allow for potential applications in drug development, particularly in areas related to neurochemistry and metabolic regulation. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C5H6N2O3
InChI:InChI=1S/C5H6N2O3/c1-2-3(6)4(5(8)9)10-7-2/h6H2,1H3,(H,8,9)
InChI key:InChIKey=PGHZTAUDNFUBAU-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(N)C(C)=NO1
Synonyms:
  • 5-Isoxazolecarboxylic acid, 4-amino-3-methyl-
  • 4-Amino-3-methyl-5-isoxazolecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.