CAS 83992-95-4
:4-Bis(4-methylphenyl)aminobenzaldehyde-1,1-diphenyl-hydrazone
Description:
4-Bis(4-methylphenyl)aminobenzaldehyde-1,1-diphenyl-hydrazone, with the CAS number 83992-95-4, is an organic compound characterized by its complex structure, which includes multiple aromatic rings and functional groups. This compound typically exhibits a deep color, often used as a dye or pigment in various applications. It is known for its stability under normal conditions, but like many organic compounds, it may be sensitive to light and heat, which can affect its properties. The presence of the hydrazone functional group suggests potential reactivity, particularly in condensation reactions or as a ligand in coordination chemistry. Additionally, its solubility may vary depending on the solvent, often being more soluble in organic solvents than in water. The compound's unique structure contributes to its potential applications in fields such as organic electronics, materials science, and as a reagent in chemical synthesis. Safety precautions should be taken when handling this substance, as with many organic chemicals, due to potential toxicity and environmental impact.
Formula:C33H29N3
InChI:InChI=1/C33H29N3/c1-26-13-19-29(20-14-26)35(30-21-15-27(2)16-22-30)31-23-17-28(18-24-31)25-34-36(32-9-5-3-6-10-32)33-11-7-4-8-12-33/h3-25H,1-2H3/b34-25+
Synonyms:- 4-[Bis(4-methylphenyl)amino]-benzaldehyde diphenylhydrazone
- 4,4'-Bis(4-methylphenyl)aminobenzaldehyde-1,1-diphenylhydrazone
- 4-Bis(4-methylphenyl)aminobenzo-aldehyde-1,1-diphenyl-hydrazone
- 4-[(E)-(diphenylhydrazono)methyl]-N,N-bis(4-methylphenyl)aniline
- (HCT-106) 4-Bis(4-methylphenyl)aminobenzo-aldehyde-1,1-diphenyl-hydrazone
- 4-N,N-Bis(4-methylphenyl)amino-benzaldehyde-N,N-diphenylhydrazone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.