CAS 84-23-1
:Naphth[1,2-d][1,2,3]oxadiazole-5-sulfonic acid
Description:
Naphth[1,2-d][1,2,3]oxadiazole-5-sulfonic acid, with the CAS number 84-23-1, is a heterocyclic compound characterized by its fused naphthalene and oxadiazole rings, along with a sulfonic acid functional group. This compound typically exhibits a high degree of stability due to its aromatic structure, which contributes to its potential applications in various fields, including materials science and organic electronics. The presence of the sulfonic acid group enhances its solubility in polar solvents, making it useful in aqueous environments. Additionally, the compound may display interesting photophysical properties, such as fluorescence, which can be exploited in dye applications or as a probe in biochemical assays. Its unique structure allows for potential interactions with biological systems, making it a candidate for further research in medicinal chemistry. Overall, Naphth[1,2-d][1,2,3]oxadiazole-5-sulfonic acid is a versatile compound with promising applications in both scientific research and industrial processes.
Formula:C10H6N2O4S
InChI:InChI=1/C10H6N2O4S/c13-17(14,15)9-5-8-10(11-12-16-8)7-4-2-1-3-6(7)9/h1-5H,(H,13,14,15)
InChI key:InChIKey=WHHIIGNOLGKQPD-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)C=1C=2C(C3=C(C1)ON=N3)=CC=CC2
Synonyms:- 3-Oxa-1,2-diaza-cyclopenta[a]naphthalene-5-sulfonic acid
- Naphth(1,2-d)(1,2,3)oxadiazole-5-sulfonic acid
- Naphtho[1,2-D][1,2,3]Oxadiazole-5-Sulfonic Acid
- Nsc 65884
- Naphth(1,2-d)(1,2,3)oxadiazole-5-sulphonic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.