CAS 84-33-3

9,10-Dihydro-3-hydroxy-9,10-dioxo-2-anthracenecarboxylic acid

Description:

9,10-Dihydro-3-hydroxy-9,10-dioxo-2-anthracenecarboxylic acid, commonly referred to as anthraquinone-2-carboxylic acid, is an organic compound characterized by its anthracene backbone, which consists of three fused benzene rings. This compound features two carbonyl groups (dioxo) and a hydroxyl group, contributing to its reactivity and potential applications in various fields. It is typically a solid at room temperature and exhibits a range of colors depending on its form and purity. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. Additionally, the compound is known for its potential use in dye manufacturing, as well as in the synthesis of other organic compounds. Its structure allows for strong π-π stacking interactions, which can influence its solubility and crystallization behavior. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure.

Formula: C₁₅H₈O₅

InChI: InChI=1S/C15H8O5/c16-12-6-10-9(5-11(12)15(19)20)13(17)7-3-1-2-4-8(7)14(10)18/h1-6,16H,(H,19,20)

InChI key: InChIKey=BLCNBYUENJBFPA-UHFFFAOYSA-N

SMILES: O=C1C=2C(C(=O)C=3C1=CC=CC3)=CC(O)=C(C(O)=O)C2

Synonyms:

• 9,10-Dihydro-3-hydroxy-9,10-dioxo-2-anthracenecarboxylic acid
• 2-Anthracenecarboxylic acid, 9,10-dihydro-3-hydroxy-9,10-dioxo-
• Ophiohayatone C
• 2-Anthroic acid, 9,10-dihydro-3-hydroxy-9,10-dioxo-
• 3-Hydroxyanthraquinone-2-carboxylic acid

Ophiohayatone C

CAS: 84-33-3

Ophiohayatone C is a bioactive compound classified as a saponin, which is derived from the Ophiocordyceps genus, a type of parasitic fungus known for its various medicinal properties. The compound has garnered attention due to its cytotoxic activity, which is a result of its ability to induce apoptosis in cancer cells. This effect is mediated through pathways that involve the disruption of cellular membranes and inhibition of specific signal transduction mechanisms critical for cell survival.

Formula: C₁₅H₈O₅

Purity: Min. 95%

Molecular weight: 268.22 g/mol

Ref: 3D-AAA08433