CAS 84-42-4

N-(3-Chloro-9,10-dihydro-9,10-dioxo-2-anthracenyl)acetamide

Description:

N-(3-Chloro-9,10-dihydro-9,10-dioxo-2-anthracenyl)acetamide, with the CAS number 84-42-4, is a synthetic organic compound characterized by its anthracene-derived structure. This compound features a chloro substituent and an acetamide functional group, contributing to its unique chemical properties. It typically exhibits a solid state at room temperature and is known for its potential applications in various fields, including pharmaceuticals and materials science. The presence of the dioxo groups indicates that it may participate in redox reactions, while the chloro group can enhance its reactivity and solubility in organic solvents. Additionally, the compound may display fluorescence properties due to its aromatic structure, making it of interest in photonic applications. Safety data should be consulted, as compounds with halogenated groups can pose environmental and health risks. Overall, N-(3-Chloro-9,10-dihydro-9,10-dioxo-2-anthracenyl)acetamide is a notable compound in organic chemistry with diverse potential applications.

Formula: C₁₆H₁₀ClNO₃

InChI: InChI=1S/C16H10ClNO3/c1-8(19)18-14-7-12-11(6-13(14)17)15(20)9-4-2-3-5-10(9)16(12)21/h2-7H,1H3,(H,18,19)

InChI key: InChIKey=AHCFUKJIRUAIDZ-UHFFFAOYSA-N

SMILES: O=C1C=2C(C(=O)C=3C1=CC=CC3)=CC(Cl)=C(NC(C)=O)C2

Synonyms:

• 2-Acetamido-3-chloroanthraquinone
• N-(3-Chloro-9,10-dihydro-9,10-dioxo-2-anthracenyl)acetamide
• Anthraquinone, 2-acetamido-3-chloro-
• 2-Chloro-3-(acetylamino)anthraquinone
• Acetamide, N-(3-chloro-9,10-dihydro-9,10-dioxo-2-anthracenyl)-