CAS 84-76-4: Dinonyl phthalate
Description:Dinonyl phthalate (CAS 84-76-4) is an organic compound belonging to the phthalate family, primarily used as a plasticizer to enhance the flexibility and durability of plastics, particularly polyvinyl chloride (PVC). It is characterized by its high molecular weight and low volatility, which contribute to its effectiveness in improving the mechanical properties of materials. Dinonyl phthalate is typically a colorless to pale yellow liquid with a mild odor. It exhibits good thermal stability and resistance to degradation, making it suitable for various applications, including in the production of flexible films, coatings, and adhesives. Additionally, it has low water solubility and is relatively inert, which helps in maintaining the integrity of the products it is used in. However, like other phthalates, there are concerns regarding its environmental impact and potential health effects, leading to increased scrutiny and regulation in many regions. Overall, dinonyl phthalate plays a significant role in the plastics industry while also raising important considerations regarding safety and sustainability.
Formula:C26H42O4
InChI:InChI=1S/C26H42O4/c1-3-5-7-9-11-13-17-21-29-25(27)23-19-15-16-20-24(23)26(28)30-22-18-14-12-10-8-6-4-2/h15-16,19-20H,3-14,17-18,21-22H2,1-2H3
InChI key:InChIKey=DROMNWUQASBTFM-UHFFFAOYSA-N
SMILES:O=C(OCCCCCCCCC)C=1C=CC=CC1C(=O)OCCCCCCCCC
- Synonyms:
- 1,2-Benzenedicarboxylic acid, 1,2-dinonyl ester
- 1,2-Benzenedicarboxylic acid, dinonyl ester
- 1,2-Dinonyl benzene-1,2-dicarboxylate
- Bisoflex 91
- Bisoflex DNP
- Di-n-nonyl phthalate
- Dinonyl 1,2-benzenedicarboxylate
- Dinonyl o-phthalate
- Phthalic acid, dinonyl ester
- Phthalic anhydride diester with Linevol 9
- See more synonyms
- Synplast 9P-N
- Unimoll DN
