CAS 84-92-4

5,6-Diamino-1-naphthalenesulfonic acid

Description:

5,6-Diamino-1-naphthalenesulfonic acid, with the CAS number 84-92-4, is an organic compound characterized by its naphthalene structure substituted with two amino groups and a sulfonic acid group. This compound appears as a solid, typically in a crystalline form, and is soluble in water due to the presence of the sulfonic acid group, which enhances its polarity. It is primarily used in the dye industry, particularly for the synthesis of azo dyes, owing to its ability to form stable dye intermediates. The amino groups contribute to its reactivity, allowing for various chemical modifications. Additionally, 5,6-diamino-1-naphthalenesulfonic acid exhibits properties such as being a strong reducing agent and can participate in various redox reactions. Safety considerations include handling it with care, as it may pose health risks upon exposure. Overall, this compound plays a significant role in organic synthesis and dye production, showcasing the versatility of naphthalene derivatives in chemical applications.

Formula: C₁₀H₁₀N₂O₃S

InChI: InChI=1S/C10H10N2O3S/c11-8-5-4-6-7(10(8)12)2-1-3-9(6)16(13,14)15/h1-5H,11-12H2,(H,13,14,15)

InChI key: InChIKey=AWXNJVXWJMGHMQ-UHFFFAOYSA-N

SMILES: S(=O)(=O)(O)C=1C2=C(C(N)=C(N)C=C2)C=CC1

Synonyms:

• 1,2-Diamino-5-naphthalenesulfonic acid
• 5,6-Diamino-1-naphthalenesulfonic acid
• 1-Naphthalenesulfonic acid, 5,6-diamino-
• 1,2-Naphthalenediamine-5-sulfonic acid