CAS 840-59-5
:6-methyl-3-(4-methylphenyl)-3,4-dihydroquinazoline
Description:
6-Methyl-3-(4-methylphenyl)-3,4-dihydroquinazoline, identified by its CAS number 840-59-5, is a chemical compound belonging to the quinazoline family, which is characterized by a bicyclic structure containing a benzene ring fused to a pyrimidine ring. This compound typically exhibits a pale yellow to light brown appearance and is known for its potential biological activities, including antimicrobial and anticancer properties. The presence of the methyl groups on both the quinazoline and phenyl rings can influence its solubility and reactivity, making it of interest in medicinal chemistry. Its molecular structure allows for various interactions with biological targets, which can be explored for therapeutic applications. Additionally, the compound's stability and reactivity can be affected by environmental conditions, such as pH and temperature. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity or reactivity. Overall, 6-methyl-3-(4-methylphenyl)-3,4-dihydroquinazoline represents a significant area of study in the field of organic and medicinal chemistry.
Formula:C16H16N2
InChI:InChI=1/C16H16N2/c1-12-3-6-15(7-4-12)18-10-14-9-13(2)5-8-16(14)17-11-18/h3-9,11H,10H2,1-2H3
SMILES:Cc1ccc(cc1)N1Cc2cc(C)ccc2N=C1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.