CAS 840-79-9

N'-(pyridin-2-ylcarbonyl)pyridine-2-carbohydrazide

Description:

N'-(pyridin-2-ylcarbonyl)pyridine-2-carbohydrazide, with the CAS number 840-79-9, is a chemical compound that features a hydrazide functional group linked to a pyridine moiety. This compound typically exhibits characteristics common to hydrazides, such as the ability to form hydrogen bonds due to the presence of the hydrazide functional group, which can influence its solubility and reactivity. The presence of two pyridine rings contributes to its aromaticity and may enhance its stability and potential for coordination with metal ions. This compound is often studied for its biological activity, particularly in medicinal chemistry, where derivatives of hydrazides are known for their antimicrobial and anticancer properties. Additionally, its structural features may allow for various synthetic modifications, making it a versatile building block in organic synthesis. Overall, N'-(pyridin-2-ylcarbonyl)pyridine-2-carbohydrazide is of interest in both academic research and potential pharmaceutical applications.

Formula: C₁₂H₁₀N₄O₂

InChI: InChI=1/C12H10N4O2/c17-11(9-5-1-3-7-13-9)15-16-12(18)10-6-2-4-8-14-10/h1-8H,(H,15,17)(H,16,18)

SMILES: c1ccnc(c1)C(=NN=C(c1ccccn1)O)O

Synonyms:

• 2-Pyridinecarboxylic Acid, 2-(2-Pyridinylcarbonyl)Hydrazide

N,N'-Dipyridoylhydrazine

Controlled Product

CAS: 840-79-9

Formula: C₁₂H₁₀N₄O₂

Color and Shape: Neat

Molecular weight: 242.233

Ref: TR-D795430