
CAS 840-80-2
:Acroteben
Description:
Acroteben, with the CAS number 840-80-2, is a chemical compound primarily used as a plasticizer and solvent in various industrial applications. It is characterized by its low volatility and ability to enhance the flexibility and durability of polymers. Acroteben is typically a colorless to pale yellow liquid with a mild odor, and it exhibits good compatibility with a range of organic materials. Its chemical structure includes a branched alkyl chain, which contributes to its effectiveness as a plasticizer. Additionally, Acroteben is known for its relatively low toxicity, making it a preferable choice in formulations where human exposure is a concern. However, like many chemical substances, it should be handled with care, following appropriate safety guidelines to minimize any potential risks. Its applications extend to coatings, adhesives, and sealants, where it helps improve performance characteristics. Overall, Acroteben serves as a versatile additive in the chemical industry, contributing to the enhancement of material properties.
Formula:C13H11N3O2
InChI:InChI=1S/C13H11N3O2/c17-12-3-1-2-10(8-12)9-15-16-13(18)11-4-6-14-7-5-11/h1-9,17H,(H,16,18)
InChI key:InChIKey=WJVBIMBJLVWPNE-UHFFFAOYSA-N
SMILES:C(NN=CC1=CC(O)=CC=C1)(=O)C=2C=CN=CC2
Synonyms:- 4-Pyridinecarboxylic acid, [(3-hydroxyphenyl)methylene]hydrazide
- Hydrazine, 1-m-hydroxybenzylidene-2-isonicotinoyl-
- 4-Pyridinecarboxylic acid, 2-[(3-hydroxyphenyl)methylene]hydrazide
- Benzaldehyde, m-hydroxy-, isonicotinoylhydrazone
- Isonicotinic acid, (m-hydroxybenzylidene)hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
