CymitQuimica logo

CAS 84000-12-4

:

Fmoc-N-Me-Met-OH

Description:
Fmoc-N-Me-Met-OH, also known as Fmoc-N-methyl-methionine, is a chemical compound commonly used in peptide synthesis and research. It features a fluorenylmethoxycarbonyl (Fmoc) protecting group, which is widely utilized for the protection of amino groups during the synthesis of peptides. The presence of the N-methyl group indicates that the amino group is substituted, which can influence the steric and electronic properties of the molecule. Methionine, an essential amino acid, contributes to the compound's biological relevance, particularly in protein synthesis. Fmoc-N-Me-Met-OH is typically a white to off-white solid and is soluble in organic solvents such as dimethylformamide (DMF) and dimethyl sulfoxide (DMSO), but less soluble in water. Its stability under standard laboratory conditions makes it a valuable reagent in organic synthesis. Additionally, the compound's structure allows for easy removal of the Fmoc group under mild basic conditions, facilitating the subsequent coupling reactions in peptide synthesis. Overall, Fmoc-N-Me-Met-OH is an important tool in the field of biochemistry and molecular biology.
Formula:C21H23NO4S
InChI:InChI=1S/C21H23NO4S/c1-22(19(20(23)24)11-12-27-2)21(25)26-13-18-16-9-5-3-7-14(16)15-8-4-6-10-17(15)18/h3-10,18-19H,11-13H2,1-2H3,(H,23,24)/t19-/m0/s1
InChI key:SPYUJXKMEJUAOI-IBGZPJMESA-N
SMILES:CN([C@@H](CCSC)C(=O)O)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13
Synonyms:
  • Fmoc-N-methyl-L-methionine
  • Fmoc-N-Me-L-Met-OH
Found 4 products.