CymitQuimica logo

CAS 84003-58-7

:

9-benzyl-2-fluoro-9H-purine

Description:
9-Benzyl-2-fluoro-9H-purine is a purine derivative characterized by the presence of a benzyl group at the 9-position and a fluorine atom at the 2-position of the purine ring. This compound exhibits properties typical of purines, including potential biological activity, as purines are fundamental components of nucleic acids and play critical roles in cellular processes. The introduction of the benzyl group can enhance lipophilicity, potentially affecting the compound's ability to cross biological membranes. The fluorine atom may influence the compound's reactivity and stability, as well as its interaction with biological targets. 9-Benzyl-2-fluoro-9H-purine may be of interest in medicinal chemistry for its potential as an antiviral or anticancer agent, given the importance of purine analogs in drug design. Its molecular structure allows for various modifications, which can lead to the development of novel therapeutic agents. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C12H9FN4
InChI:InChI=1/C12H9FN4/c13-12-14-6-10-11(16-12)17(8-15-10)7-9-4-2-1-3-5-9/h1-6,8H,7H2
SMILES:c1ccc(cc1)Cn1cnc2cnc(F)nc12
Synonyms:
  • 9H-purine, 2-fluoro-9-(phenylmethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.