CAS 84012-62-4
:2,10-Dimethyl-6-undecanone
Description:
2,10-Dimethyl-6-undecanone, with the CAS number 84012-62-4, is a ketone characterized by its long carbon chain and branched structure. It features a total of 11 carbon atoms, with two methyl groups located at the second and tenth positions, and a ketone functional group at the sixth position. This compound is typically a colorless to pale yellow liquid with a distinctive odor, often described as sweet or fruity. It is relatively hydrophobic, meaning it has low solubility in water but is soluble in organic solvents. The presence of the ketone functional group contributes to its reactivity, allowing it to participate in various chemical reactions, such as nucleophilic additions. 2,10-Dimethyl-6-undecanone is used in flavoring and fragrance applications due to its pleasant aroma. Additionally, it may have applications in organic synthesis and as an intermediate in the production of other chemical compounds. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C13H26O
InChI:InChI=1S/C13H26O/c1-11(2)7-5-9-13(14)10-6-8-12(3)4/h11-12H,5-10H2,1-4H3
InChI key:InChIKey=GEDUSQFJZAKUOH-UHFFFAOYSA-N
SMILES:C(CCCC(C)C)(CCCC(C)C)=O
Synonyms:- 2,10-Dimethylundecan-6-one
- 2,10-Dimethyl-6-undecanone
- 6-Undecanone, 2,10-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.