CAS 84016-40-0

4'-butylbiphenyl-4-ol

Description:

4'-Butylbiphenyl-4-ol, with the CAS number 84016-40-0, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a butyl group at the para position of one phenyl ring and a hydroxyl (-OH) group at the para position of the other phenyl ring contributes to its unique properties. This compound is typically a solid at room temperature and exhibits moderate solubility in organic solvents, while being less soluble in water due to its hydrophobic characteristics. The hydroxyl group imparts some polar characteristics, allowing for potential hydrogen bonding interactions. 4'-Butylbiphenyl-4-ol may be utilized in various applications, including as an intermediate in organic synthesis or in the formulation of specialty chemicals. Its physical and chemical properties, such as melting point, boiling point, and reactivity, can vary based on the specific conditions and purity of the sample. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₁₆H₁₈O

InChI: InChI=1/C16H18O/c1-2-3-4-13-5-7-14(8-6-13)15-9-11-16(17)12-10-15/h5-12,17H,2-4H2,1H3

SMILES: CCCCc1ccc(cc1)c1ccc(cc1)O

Synonyms:

• [1,1'-Biphenyl]-4-Ol, 4'-Butyl-