CAS 84028-90-0

N-(Phenylmethyl)-D-phenylalanine methyl ester

Description:

N-(Phenylmethyl)-D-phenylalanine methyl ester, with the CAS number 84028-90-0, is an organic compound that belongs to the class of amino acid derivatives. This substance features a phenylalanine backbone, which is an essential amino acid, modified by the addition of a phenylmethyl group and a methyl ester functional group. The presence of the phenylmethyl group enhances its lipophilicity, potentially influencing its biological activity and interactions with various receptors or enzymes. The methyl ester moiety can affect the compound's solubility and stability, making it more amenable to certain chemical reactions or biological processes. This compound may be of interest in pharmaceutical research, particularly in the development of peptide-based drugs or as a building block in organic synthesis. Its specific properties, such as melting point, solubility, and reactivity, would depend on the molecular structure and the conditions under which it is studied. As with many amino acid derivatives, it may exhibit unique biological activities, warranting further investigation in medicinal chemistry.

Formula: C₁₇H₁₉NO₂

InChI: InChI=1S/C17H19NO2/c1-20-17(19)16(12-14-8-4-2-5-9-14)18-13-15-10-6-3-7-11-15/h2-11,16,18H,12-13H2,1H3/t16-/m1/s1

InChI key: InChIKey=GVTZTBHOYNXMKJ-MRXNPFEDSA-N

SMILES: [C@@H](CC1=CC=CC=C1)(C(OC)=O)NCC2=CC=CC=C2

Synonyms:

• D-Phenylalanine, N-(phenylmethyl)-, methyl ester
• N-(Phenylmethyl)-D-phenylalanine methyl ester