
CAS 84030-79-5
:Dibenzo[a,k]fluoranthene
Description:
Dibenzo[a,k]fluoranthene is a polycyclic aromatic hydrocarbon (PAH) characterized by its complex fused ring structure, which consists of five fused benzene rings. It is a colorless to pale yellow solid at room temperature and is known for its hydrophobic nature, making it poorly soluble in water but soluble in organic solvents. This compound is primarily of interest due to its potential environmental and health impacts, as it is a byproduct of incomplete combustion processes, such as those occurring in vehicle emissions and industrial activities. Dibenzo[a,k]fluoranthene is classified as a possible human carcinogen, raising concerns regarding its presence in air, soil, and sediments. Its persistence in the environment and bioaccumulation potential in living organisms further underscore the importance of monitoring and regulating its levels. Additionally, it exhibits fluorescence properties, which can be utilized in analytical techniques for detection and quantification in environmental samples. Overall, dibenzo[a,k]fluoranthene serves as a significant subject of study in environmental chemistry and toxicology.
Formula:C24H14
InChI:InChI=1S/C24H14/c1-2-7-16-14-22-21(13-15(16)6-1)20-11-5-9-18-12-17-8-3-4-10-19(17)24(22)23(18)20/h1-14H
InChI key:InChIKey=QTOPJEQPIXGHRY-UHFFFAOYSA-N
SMILES:C1=2C=3C(C=4C1=CC=5C(C4)=CC=CC5)=CC=CC3C=C6C2C=CC=C6
Synonyms:- Dibenzo[a,k]fluoranthene
- Naphth[2,3-a]aceanthrylene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.