CAS 840481-82-5

3-Bromo-2-fluorobenzonitrile

Description:

3-Bromo-2-fluorobenzonitrile is an organic compound characterized by the presence of both bromine and fluorine substituents on a benzene ring, along with a nitrile functional group. Its molecular structure features a benzene ring with a bromine atom at the meta position (3) and a fluorine atom at the ortho position (2) relative to the nitrile group (-C≡N) at the para position. This compound is typically a colorless to pale yellow solid and is known for its utility in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The presence of halogens (bromine and fluorine) enhances its reactivity, making it a valuable intermediate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the nitrile group contributes to its polar character, influencing its solubility in organic solvents. Safety data indicates that it should be handled with care due to potential toxicity and environmental hazards associated with halogenated compounds.

Formula: C₇H₃BrFN

InChI: InChI=1/C7H3BrFN/c8-6-3-1-2-5(4-10)7(6)9/h1-3H

SMILES: c1cc(C#N)c(c(c1)Br)F

Synonyms:

• Benzonitrile, 3-bromo-2-fluoro-

3-Bromo-2-fluorobenzonitrile

CAS: 840481-82-5

3-Bromo-2-fluorobenzonitrile

Formula: C₇H₃BrFN

Purity: 98%

Color and Shape: very faint orange crystalline powder

Molecular weight: 200.01g/mol

Ref: 54-PC6975

3-Bromo-2-fluorobenzonitrile

CAS: 840481-82-5

Formula: C₇H₃BrFN

Purity: 96%

Color and Shape: Solid, Crystalline Powder or Powder

Molecular weight: 200.01

Ref: 10-F023918