CymitQuimica logo

CAS 840481-83-6

:

3-Amino-7-bromobenzo[b]thiophene-2-carboxamide

Description:
3-Amino-7-bromobenzo[b]thiophene-2-carboxamide is a chemical compound characterized by its unique structure, which includes a benzo[b]thiophene core substituted with an amino group and a bromine atom. This compound features a carboxamide functional group, contributing to its potential as a bioactive molecule. The presence of the bromine atom enhances its reactivity and may influence its pharmacological properties. The amino group can participate in hydrogen bonding, which is significant for interactions with biological targets. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in areas such as cancer research or as a scaffold for designing new therapeutic agents. Additionally, the compound's solubility, stability, and reactivity can be influenced by the presence of the bromine and amino groups, which are critical for its behavior in different chemical environments. Overall, 3-Amino-7-bromobenzo[b]thiophene-2-carboxamide represents a versatile structure with potential implications in various fields of research.
Formula:C9H7BrN2OS
InChI:InChI=1S/C9H7BrN2OS/c10-5-3-1-2-4-6(11)8(9(12)13)14-7(4)5/h1-3H,11H2,(H2,12,13)
InChI key:InChIKey=MZINLYCMHKMJSF-UHFFFAOYSA-N
SMILES:BrC1=C2C(C(N)=C(C(N)=O)S2)=CC=C1
Synonyms:
  • Benzo[b]thiophene-2-carboxamide, 3-amino-7-bromo-
  • 3-Amino-7-bromobenzo[b]thiophene-2-carboxamide
  • 3-Amino-7-bromo-1-benzothiophene-2-carboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.