CAS 840521-79-1

Ethyl 4,4-difluoro-2-methoxy-3-oxobutanoate

Description:

Ethyl 4,4-difluoro-2-methoxy-3-oxobutanoate is an organic compound characterized by its unique functional groups and structural features. It contains an ester functional group, which is typical for compounds with the "ethyl" prefix, indicating the presence of an ethyl group. The molecule features a diketone structure due to the presence of the oxobutanoate moiety, which contributes to its reactivity and potential applications in organic synthesis. The presence of two fluorine atoms at the 4-position enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. Additionally, the methoxy group at the 2-position can participate in various chemical reactions, such as nucleophilic substitutions or eliminations. This compound may be utilized in the synthesis of more complex molecules or as an intermediate in pharmaceutical development. Its specific properties, such as solubility, boiling point, and reactivity, would depend on the overall molecular structure and the interactions of its functional groups.

Formula: C₇H₁₀F₂O₄

InChI: InChI=1S/C7H10F2O4/c1-3-13-7(11)5(12-2)4(10)6(8)9/h5-6H,3H2,1-2H3

InChI key: InChIKey=LMNQHSHJXFKRQY-UHFFFAOYSA-N

SMILES: C(C(C(F)F)=O)(C(OCC)=O)OC

Synonyms:

• Butanoic acid, 4,4-difluoro-2-methoxy-3-oxo-, ethyl ester
• Ethyl 4,4-difluoro-2-methoxy-3-oxobutanoate

4,4-Difluoro-2-methoxyacetoacetate

CAS: 840521-79-1

Formula: C₅H₆F₂O₄

Color and Shape: Liquid

Molecular weight: 168.096

Ref: 10-F022048