CAS 840522-20-5
:3′-Fluoro[1,1′-biphenyl]-3-ethanol
Description:
3′-Fluoro[1,1′-biphenyl]-3-ethanol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluoro group at the 3′ position of one of the phenyl rings introduces a halogen substituent, which can influence the compound's reactivity and physical properties. The hydroxyl (-OH) group at the 3 position of the biphenyl framework contributes to its classification as an alcohol, affecting its solubility and hydrogen bonding capabilities. This compound may exhibit interesting biological activity due to the combination of the fluoro substituent and the alcohol functional group, potentially impacting its interactions with biological systems. Additionally, the molecular structure suggests that it could be used in various applications, including pharmaceuticals and materials science. Its CAS number, 840522-20-5, allows for easy identification and reference in chemical databases. Overall, 3′-Fluoro[1,1′-biphenyl]-3-ethanol is a compound of interest in both synthetic and applied chemistry contexts.
Formula:C14H13FO
InChI:InChI=1S/C14H13FO/c15-14-6-2-5-13(10-14)12-4-1-3-11(9-12)7-8-16/h1-6,9-10,16H,7-8H2
InChI key:InChIKey=FMHKJMVEPWSTOD-UHFFFAOYSA-N
SMILES:C(CO)C=1C=C(C=CC1)C2=CC(F)=CC=C2
Synonyms:- 3′-Fluoro[1,1′-biphenyl]-3-ethanol
- [1,1′-Biphenyl]-3-ethanol, 3′-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
