CymitQuimica logo

CAS 84063-18-3

:

8-Quinolinol, homopolymer

Description:
8-Quinolinol, homopolymer, identified by CAS number 84063-18-3, is a synthetic polymer derived from the polymerization of 8-quinolinol monomers. This compound exhibits unique characteristics due to the presence of quinoline moieties, which contribute to its chelating properties, allowing it to form stable complexes with various metal ions. The polymer is typically characterized by its high thermal stability and resistance to degradation, making it suitable for various applications, including as a stabilizer in plastics and as a corrosion inhibitor. Additionally, 8-quinolinol derivatives are known for their antimicrobial and antifungal activities, which may extend to the homopolymer form. The polymer's solubility can vary depending on its molecular weight and the presence of functional groups, influencing its processing and application potential. Overall, 8-quinolinol, homopolymer, is a versatile material with significant implications in fields such as materials science, pharmaceuticals, and environmental chemistry.
Formula:(C9H7NO)x
InChI:InChI=1S/C9H7NO/c11-8-5-1-3-7-4-2-6-10-9(7)8/h1-6,11H
InChI key:InChIKey=MCJGNVYPOGVAJF-UHFFFAOYSA-N
SMILES:OC=1C2=C(C=CC1)C=CC=N2
Synonyms:
  • Poly(8-hydroxyquinoline)
  • 8-Quinolinol, homopolymer
  • 8-Hydroxyquinoline homopolymer
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.