CAS 84066-20-6

2-[(3-chloro-2-pyrazinyl)amino]-1-ethanol

Description:

2-[(3-chloro-2-pyrazinyl)amino]-1-ethanol, with the CAS number 84066-20-6, is a chemical compound characterized by its unique structure that includes a pyrazine ring substituted with a chlorine atom and an amino group linked to an ethanol moiety. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of the hydroxyl (-OH) group in the ethanol part of the molecule. The chlorine substituent can influence its reactivity and biological activity, making it of interest in medicinal chemistry. The amino group may participate in hydrogen bonding, enhancing its interactions with biological targets. Additionally, the compound may exhibit specific pharmacological properties, which could be explored in drug development contexts. Safety data and handling precautions should be considered, as with any chemical, particularly those with halogen substituents. Overall, 2-[(3-chloro-2-pyrazinyl)amino]-1-ethanol represents a compound of interest for further research in various chemical and biological applications.

Formula: C₆H₈ClN₃O

InChI: InChI=1/C6H8ClN3O/c7-5-6(10-3-4-11)9-2-1-8-5/h1-2,11H,3-4H2,(H,9,10)

SMILES: c1c[nH]c(=NCCO)c(Cl)n1

Synonyms:

• 2-[(3-Chloropyrazin-2-Yl)Amino]Ethanol

2-[(3-Chloropyrazin-2-yl)amino]-1-ethanol

CAS: 84066-20-6

2-[(3-Chloropyrazin-2-yl)amino]-1-ethanol

Purity: ≥95%

Molecular weight: 173.60g/mol

Ref: 54-OR27773