CAS 84069-38-5

ethyl 6-deoxy-3,5-di-O-methyl-6-{[methyl(nitroso)carbamoyl]amino}-alpha-D-glucofuranoside

Description:

Ethyl 6-deoxy-3,5-di-O-methyl-6-{[methyl(nitroso)carbamoyl]amino}-alpha-D-glucofuranoside, with the CAS number 84069-38-5, is a complex organic compound characterized by its structural features derived from the D-glucose framework. This substance contains multiple functional groups, including methoxy groups and a nitroso carbamoyl moiety, which contribute to its chemical reactivity and potential biological activity. The presence of the ethyl group suggests it may exhibit lipophilic properties, influencing its solubility and interaction with biological membranes. The compound's furanose form indicates it is a sugar derivative, which may play a role in its biological functions, such as acting as a substrate or inhibitor in enzymatic reactions. Its nitroso group may impart unique reactivity, potentially allowing for interactions with nucleophiles or participation in redox reactions. Overall, this compound's intricate structure suggests it could be of interest in medicinal chemistry or biochemistry, particularly in the study of glycosylation processes or as a potential therapeutic agent.

Formula: C₁₂H₂₃N₃O₇

InChI: InChI=1/C12H23N3O7/c1-5-21-11-8(16)10(20-4)9(22-11)7(19-3)6-13-12(17)15(2)14-18/h7-11,16H,5-6H2,1-4H3,(H,13,17)/t7-,8-,9-,10-,11+/m1/s1

Cgp 6809

CAS: 84069-38-5

CGP 6809: a methylnitrosoureido-sugar derivative active against various mice/rat tumors; promising for bowel/lung cancer trials.

Formula: C₁₂H₂₃N₃O₇

Color and Shape: Solid

Molecular weight: 321.33

Ref: TM-T30842