CAS 84077-81-6

2,2-di(4-tert-octylphenyl)-1-picryl-hydrazyl

Description:

2,2-Di(4-tert-octylphenyl)-1-picryl-hydrazyl, commonly referred to as a stable free radical, is characterized by its unique structure that includes a hydrazyl group and bulky tert-octylphenyl substituents. This compound is known for its stability due to the delocalization of the unpaired electron, which contributes to its radical nature. It exhibits significant solubility in organic solvents, making it useful in various applications, including as a spin probe in electron paramagnetic resonance (EPR) spectroscopy. The presence of the bulky tert-octyl groups enhances its solubility and steric hindrance, which can influence its reactivity and interactions with other molecules. Additionally, this compound can serve as an antioxidant due to its ability to scavenge free radicals, thus playing a role in protecting against oxidative stress in biological systems. Its unique properties make it valuable in research and industrial applications, particularly in the fields of materials science and biochemistry.

Formula: C₃₄H₄₄N₅O₆

InChI: InChI=1/C34H44N5O6/c1-31(2,3)21-33(7,8)23-11-15-25(16-12-23)36(26-17-13-24(14-18-26)34(9,10)22-32(4,5)6)35-30-28(38(42)43)19-27(37(40)41)20-29(30)39(44)45/h11-20H,21-22H2,1-10H3

SMILES: CC(C)(C)CC(C)(C)c1ccc(cc1)N(c1ccc(cc1)C(C)(C)CC(C)(C)C)N=C1C(=N(=O)O)C=C(C=C1N(=O)=O)N(=O)=O

Synonyms:

• 2,2-Di(4-tert-octylphenyl)-1-picrylhydrazyl,free radical
• 2,2-Bis[4-(1,1,3,3-Tetramethylbutyl)Phenyl]-1-(2,4,6-Trinitrophenyl)Hydrazinyl

2,2-Di(4-tert-octylphenyl)-1-picrylhydrazyl, free radical

CAS: 84077-81-6

Formula: C₃₄H₄₄N₅O₆

Color and Shape: Solid

Molecular weight: 618.7431

Ref: IN-DA003FA5