CymitQuimica logo

CAS 84080-70-6

:

4-Chloro-2-(Z)-Methoxycarbonyl Methoxyimino-3-oxobutyric acid

Description:
4-Chloro-2-(Z)-Methoxycarbonyl Methoxyimino-3-oxobutyric acid, with the CAS number 84080-70-6, is a chemical compound characterized by its complex structure, which includes a chloro substituent, methoxycarbonyl group, and a methoxyimino functional group. This compound typically exhibits properties associated with both acidic and basic functionalities due to the presence of the carboxylic acid group. It is likely to be a solid at room temperature and may be soluble in polar organic solvents, reflecting its polar functional groups. The presence of the chloro atom suggests potential reactivity in nucleophilic substitution reactions, while the methoxycarbonyl and methoxyimino groups can participate in various chemical transformations, making it of interest in synthetic organic chemistry. Additionally, the Z configuration indicates a specific geometric arrangement around the double bond, which can influence the compound's reactivity and interactions with other molecules. Overall, this compound may have applications in pharmaceuticals or agrochemicals, although specific uses would depend on further research and development.
Formula:C7H8ClNO6
InChI:InChI=1/C7H8ClNO6/c1-14-5(11)3-15-9-6(7(12)13)4(10)2-8/h2-3H2,1H3,(H,12,13)
SMILES:COC(=O)CON=C(C(=O)CCl)C(=O)O
Synonyms:
  • Cmoba
  • (2Z)-4-chloro-2-[(2-methoxy-2-oxoethoxy)imino]-3-oxobutanoic acid
  • Butanoic acid, 4-chloro-2-[(2-methoxy-2-oxoethoxy)imino]-3-oxo-
  • 2-Methoxycarbonylmethoxyimino-4-Chloro-3-Oxobutyric Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.