CAS 84082-64-4
:Mucins, gastric
Description:
Mucins are high molecular weight glycoproteins primarily produced by epithelial tissues, and gastric mucins specifically play a crucial role in the gastrointestinal tract. The substance with CAS number 84082-64-4 refers to gastric mucins, which are essential for protecting the gastric epithelium from mechanical damage, pathogens, and acidic gastric secretions. These glycoproteins exhibit a complex structure characterized by a core protein backbone heavily glycosylated with oligosaccharides, which contribute to their gel-forming properties and viscosity. Gastric mucins are secreted by gastric mucous cells and are involved in maintaining the mucosal barrier, facilitating digestion, and modulating immune responses. They also play a role in the pathophysiology of various gastrointestinal disorders, including peptic ulcers and gastric cancer. The unique properties of gastric mucins, such as their ability to form protective gels and their interaction with other biomolecules, make them a subject of interest in both basic research and clinical applications.
Formula:Unspecified
InChI:InChI=1/C97H124N20O31S/c1-49(2)39-68(114-95(146)71(43-54-46-100-59-18-11-9-16-57(54)59)116-97(148)73-19-12-37-117(73)76(121)48-102-85(136)60-24-30-74(119)104-60)93(144)110-65(29-35-81(130)131)91(142)109-64(28-34-80(128)129)90(141)108-63(27-33-79(126)127)89(140)107-62(26-32-78(124)125)88(139)106-61(25-31-77(122)123)87(138)103-50(3)84(135)113-69(41-52-20-22-55(118)23-21-52)86(137)101-47-75(120)105-70(42-53-45-99-58-17-10-8-15-56(53)58)94(145)111-66(36-38-149-4)92(143)115-72(44-82(132)133)96(147)112-67(83(98)134)40-51-13-6-5-7-14-51/h5-11,13-18,20-23,45-46,49-50,60-73,99-100,118H,12,19,24-44,47-48H2,1-4H3,(H2,98,134)(H,101,137)(H,102,136)(H,103,138)(H,104,119)(H,105,120)(H,106,139)(H,107,140)(H,108,141)(H,109,142)(H,110,144)(H,111,145)(H,112,147)(H,113,135)(H,114,146)(H,115,143)(H,116,148)(H,122,123)(H,124,125)(H,126,127)(H,128,129)(H,130,131)(H,132,133)
SMILES:CC(C)CC(C(=NC(CCC(=O)O)C(=NC(CCC(=O)O)C(=NC(CCC(=O)O)C(=NC(CCC(=O)O)C(=NC(CCC(=O)O)C(=NC(C)C(=NC(Cc1ccc(cc1)O)C(=NCC(=NC(Cc1c[nH]c2ccccc12)C(=NC(CCSC)C(=NC(CC(=O)O)C(=NC(Cc1ccccc1)C(=N)O)O)O)O)O)O)O)O)O)O)O)O)O)N=C(C(Cc1c[nH]c2ccccc12)N=C(C1CCCN1C(=O)CN=C(C1CCC(=N1)O)O)O)O
Synonyms:- Gastric mucin
- Gastrin I human
- Mucin Type Ii
- Mucins, gastric
- Pyr-Gly-Pro-Trp-Leu-Glu-Glu-Glu-Glu-Glu-Ala-Tyr-Gly-Trp-Met-Asp-Phe-NH2
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Gastric mucin
CAS:Gastric mucin, a large glycoprotein, protects the gut from acid, enzymes, microbes, and physical damage.Purity:98%Color and Shape:SolidMucin ex. Porcine Stomach, Type III, 90%
CAS:Color and Shape:White to Pale yellow to Pale brown, Powder, Hazy to TurbidGastric mucin
CAS:Mucin is majorly composed of carbohydrate units, the monomer of mucin being about 640 kDa.
Purity:Min. 95%Molecular weight:1,000 g/mol




