CAS 84086-97-5

3,7-Dichloro-8-(dichloromethyl)quinoline

Description:

3,7-Dichloro-8-(dichloromethyl)quinoline is a synthetic organic compound characterized by its quinoline backbone, which is a bicyclic structure containing a benzene ring fused to a pyridine ring. This compound features two chlorine atoms at the 3 and 7 positions and a dichloromethyl group at the 8 position, contributing to its unique reactivity and potential applications. It is typically a solid at room temperature and may exhibit a range of physical properties such as solubility in organic solvents, depending on the specific conditions. The presence of multiple chlorine atoms enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry and agrochemical research. Additionally, the compound's structure suggests potential for various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Safety and handling precautions are essential due to the presence of chlorine, which can pose health risks. Overall, 3,7-Dichloro-8-(dichloromethyl)quinoline is a compound of interest for further study in various chemical and pharmaceutical applications.

Formula: C₁₀H₅Cl₄N

InChI: InChI=1S/C10H5Cl4N/c11-6-3-5-1-2-7(12)8(10(13)14)9(5)15-4-6/h1-4,10H

InChI key: InChIKey=LWFCXBKKDAIZJE-UHFFFAOYSA-N

SMILES: C(Cl)(Cl)C=1C2=C(C=CC1Cl)C=C(Cl)C=N2

Synonyms:

• 3,7-Dichloro-8-(dichloromethyl)quinoline
• Quinoline, 3,7-dichloro-8-(dichloromethyl)-