CAS 84088-82-4

5-[ethoxy(hydroxy)methylidene]-1,2-dihydro-4H-pyrrolo[3,2,1-ij]quinoline-4,6(5H)-dione

Description:

5-[Ethoxy(hydroxy)methylidene]-1,2-dihydro-4H-pyrrolo[3,2,1-ij]quinoline-4,6(5H)-dione, with the CAS number 84088-82-4, is a synthetic organic compound characterized by its complex molecular structure, which includes a pyrroloquinoline core. This compound features multiple functional groups, including an ethoxy group and a hydroxy group, contributing to its potential reactivity and solubility properties. The presence of the dione functionality suggests that it may exhibit keto-enol tautomerism, influencing its chemical behavior and interactions. The compound's unique structure may impart specific biological activities, making it of interest in medicinal chemistry and drug development. Its solubility in various solvents can vary, depending on the presence of polar and nonpolar groups. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, this substance represents a class of compounds that may have applications in pharmaceuticals or as intermediates in organic synthesis. Further studies would be necessary to elucidate its full range of properties and potential uses.

Formula: C₁₄H₁₃NO₄

InChI: InChI=1/C14H13NO4/c1-2-19-14(18)10-12(16)9-5-3-4-8-6-7-15(11(8)9)13(10)17/h3-5,18H,2,6-7H2,1H3

Synonyms:

• ETHYL 6-HYDROXY-4-OXO-1,2-DIHYDRO-4H-PYRROLO[3,2,1-IJ]QUINOLINE-5-CARBOXYLATE
• SALOR-INT L199133-1EA
• AURORA KA-1061