CAS 841-01-0
:(4-amino-2-methylpyrimidin-5-yl)methyl trihydrogen diphosphate
Description:
The chemical substance known as (4-amino-2-methylpyrimidin-5-yl)methyl trihydrogen diphosphate, with the CAS number 841-01-0, is a nucleotide derivative that plays a significant role in biochemical processes. It features a pyrimidine ring, which is a six-membered aromatic ring containing nitrogen atoms, contributing to its biological activity. The presence of the amino group at the 4-position and the methyl group at the 2-position of the pyrimidine ring enhances its solubility and reactivity. The trihydrogen diphosphate moiety indicates that it contains two phosphate groups, which are crucial for energy transfer and storage in cellular metabolism, particularly in the context of ATP and other nucleotide triphosphates. This compound is often involved in enzymatic reactions and can serve as a substrate or cofactor in various biochemical pathways. Its structural characteristics allow it to participate in hydrogen bonding and ionic interactions, making it essential for its biological functions. Overall, this compound is significant in the study of nucleotides and their roles in cellular processes.
Formula:C6H11N3O7P2
InChI:InChI=1/C6H11N3O7P2/c1-4-8-2-5(6(7)9-4)3-15-18(13,14)16-17(10,11)12/h2H,3H2,1H3,(H,13,14)(H2,7,8,9)(H2,10,11,12)
SMILES:Cc1ncc(COP(=O)(O)OP(=O)(O)O)c(=N)[nH]1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
(4-Amino-2-methylpyrimidin-5-yl)methyl Trihydrogen Diphosphate
CAS:Formula:C6H11N3O7P2Color and Shape:White To Off-WhiteMolecular weight:299.11(4-Amino-2-methylpyrimidin-5-yl)methyl Trihydrogen Diphosphate-d5
CAS:Controlled ProductFormula:C6D5H6N3O7P2Color and Shape:NeatMolecular weight:304.146
