CAS 84100-13-0

3,3,4,4,5,5,6,6,7,7,7-Undecafluoro-1-heptene

Description:

3,3,4,4,5,5,6,6,7,7,7-Undecafluoro-1-heptene is a fluorinated organic compound characterized by the presence of multiple fluorine atoms attached to a heptene backbone. This compound features a double bond between the first and second carbon atoms, which classifies it as an alkene. The extensive fluorination imparts unique properties, such as high thermal stability, low surface tension, and resistance to chemical degradation, making it useful in various applications, including specialty coatings and surfactants. Its molecular structure contributes to its hydrophobic nature, which can enhance its performance in non-stick and water-repellent formulations. Additionally, the presence of the double bond allows for potential reactivity in further chemical transformations. Due to its fluorinated nature, it may also exhibit low volatility and high resistance to oxidation. However, the environmental impact and regulatory considerations surrounding perfluorinated compounds should be taken into account when handling or utilizing this substance.

Formula: C₇H₃F₁₁

InChI: InChI=1S/C7H3F11/c1-2-3(8,9)4(10,11)5(12,13)6(14,15)7(16,17)18/h2H,1H2

InChI key: InChIKey=QAFBNSWDAGQWLF-UHFFFAOYSA-N

SMILES: C(C(C(C=C)(F)F)(F)F)(C(C(F)(F)F)(F)F)(F)F

Synonyms:

• 3,3,4,4,5,5,6,6,7,7,7-Undecafluorohept-1-ene
• 3,3,4,4,5,5,6,6,7,7,7-Undecafluoro-1-heptene
• 1-Heptene, 3,3,4,4,5,5,6,6,7,7,7-undecafluoro-