CAS 84100-14-1

Benzoxazolium, 3-methyl-2-[2-(phenylamino)ethenyl]-, iodide (1:1)

Description:

Benzoxazolium, 3-methyl-2-[2-(phenylamino)ethenyl]-, iodide (1:1) is a chemical compound characterized by its unique structure, which includes a benzoxazolium core and a phenylamino substituent. This compound typically exhibits properties associated with ionic compounds due to the presence of the iodide ion. It is likely to be a colored solid, often soluble in polar solvents, which can facilitate its use in various applications, including organic synthesis and as a potential dye or fluorescent probe. The presence of the phenylamino group may impart specific electronic properties, making it useful in electronic or photonic applications. Additionally, the compound may exhibit interesting photophysical properties, such as fluorescence or phosphorescence, depending on its molecular environment. Its stability and reactivity can be influenced by factors such as pH and solvent polarity. As with many organic compounds, safety precautions should be taken when handling this substance, as it may pose health risks or environmental hazards.

Formula: C₁₆H₁₅N₂O·I

InChI: InChI=1S/C16H14N2O.HI/c1-18-14-9-5-6-10-15(14)19-16(18)11-12-17-13-7-3-2-4-8-13;/h2-12H,1H3;1H

InChI key: InChIKey=VNSBKPUDNWRFJU-UHFFFAOYSA-N

SMILES: C[N+]=1C=2C(OC1C=CNC3=CC=CC=C3)=CC=CC2.[I-]

Synonyms:

• Benzoxazolium, 3-methyl-2-[2-(phenylamino)ethenyl]-, iodide
• Benzoxazolium, 3-methyl-2-[2-(phenylamino)ethenyl]-, iodide (1:1)
• N-[(E)-2-(3-methyl-1,3-benzoxazol-3-ium-2-yl)vinyl]aniline iodide
• Nk 120