CAS 84100-46-9

3-Methyl-3-phenyl-1,5-pentanediol

Description:

3-Methyl-3-phenyl-1,5-pentanediol, with the CAS number 84100-46-9, is an organic compound characterized by its structure, which includes a pentanediol backbone with both a methyl and a phenyl group attached to the central carbon. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its potential applications in various fields, including pharmaceuticals and as a chemical intermediate in organic synthesis. The presence of hydroxyl (-OH) groups in its structure contributes to its solubility in polar solvents and its ability to participate in hydrogen bonding, which can influence its reactivity and interactions with other substances. Additionally, the methyl and phenyl substituents can impart unique physical and chemical properties, such as increased hydrophobicity and potential aromatic interactions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₂H₁₈O₂

InChI: InChI=1S/C12H18O2/c1-12(7-9-13,8-10-14)11-5-3-2-4-6-11/h2-6,13-14H,7-10H2,1H3

InChI key: InChIKey=QIGUSNIFPVCARD-UHFFFAOYSA-N

SMILES: C(CCO)(CCO)(C)C1=CC=CC=C1

Synonyms:

• 3-Methyl-3-phenyl-1,5-pentanediol
• 3-Methyl-3-phenylpentane-1,5-diol
• 1,5-Pentanediol, 3-methyl-3-phenyl-