
CAS 84100-47-0
:α-Cyclopropyl-4-ethylbenzenemethanol
Description:
α-Cyclopropyl-4-ethylbenzenemethanol, with the CAS number 84100-47-0, is an organic compound characterized by its unique structural features. It contains a cyclopropyl group, which is a three-membered carbon ring, attached to a benzene ring that has an ethyl substituent at the para position and a hydroxymethyl group (-CH2OH) at the alpha position relative to the cyclopropyl group. This compound is likely to exhibit properties typical of alcohols, such as the ability to form hydrogen bonds, which can influence its solubility in polar solvents. The presence of the cyclopropyl group may impart distinctive reactivity and steric effects, potentially affecting its behavior in chemical reactions. Additionally, the ethyl group can contribute to the hydrophobic character of the molecule. Overall, α-Cyclopropyl-4-ethylbenzenemethanol may be of interest in various fields, including medicinal chemistry and materials science, due to its structural complexity and potential biological activity.
Formula:C12H16O
InChI:InChI=1S/C12H16O/c1-2-9-3-5-10(6-4-9)12(13)11-7-8-11/h3-6,11-13H,2,7-8H2,1H3
InChI key:InChIKey=QAJOIUSWRDELCI-UHFFFAOYSA-N
SMILES:C(O)(C1=CC=C(CC)C=C1)C2CC2
Synonyms:- α-Cyclopropyl-4-ethylbenzenemethanol
- Benzenemethanol, α-cyclopropyl-4-ethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.