
CAS 84100-50-5
:4,4-Dimethoxy-3-piperidinol
Description:
4,4-Dimethoxy-3-piperidinol is an organic compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features two methoxy (-OCH3) groups attached to the fourth carbon of the piperidine ring and a hydroxyl (-OH) group at the third carbon. The presence of these functional groups contributes to its solubility in polar solvents and influences its reactivity. Typically, compounds like 4,4-Dimethoxy-3-piperidinol exhibit properties such as moderate to high polarity, which can affect their interactions in biological systems and chemical reactions. The compound may also display potential as a building block in organic synthesis or as an intermediate in the production of pharmaceuticals. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, 4,4-Dimethoxy-3-piperidinol is of interest in various fields, including medicinal chemistry and materials science.
Formula:C7H15NO3
InChI:InChI=1S/C7H15NO3/c1-10-7(11-2)3-4-8-5-6(7)9/h6,8-9H,3-5H2,1-2H3
InChI key:InChIKey=PGEYGPSQTMWISB-UHFFFAOYSA-N
SMILES:O(C)C1(OC)C(O)CNCC1
Synonyms:- 3-Piperidinol, 4,4-dimethoxy-
- 4,4-Dimethoxy-3-piperidinol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.