CAS 84100-59-4
:5-Chloro-2-methyl-1-phenyl-1H-benzimidazole
Description:
5-Chloro-2-methyl-1-phenyl-1H-benzimidazole is an organic compound characterized by its benzimidazole core, which consists of a fused benzene and imidazole ring. The presence of a chlorine atom at the 5-position and a methyl group at the 2-position, along with a phenyl group at the 1-position, contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic aromatic structure. It is often studied for its potential biological activities, including antimicrobial and antifungal properties, making it of interest in pharmaceutical research. The compound's structure allows for various interactions with biological targets, which can be influenced by the substituents on the benzimidazole ring. Additionally, its stability and reactivity can be affected by the presence of the chlorine atom, which can participate in electrophilic substitution reactions. Overall, 5-Chloro-2-methyl-1-phenyl-1H-benzimidazole is a compound of interest in both synthetic and medicinal chemistry.
Formula:C14H11ClN2
InChI:InChI=1/C14H11ClN2/c1-10-16-13-9-11(15)7-8-14(13)17(10)12-5-3-2-4-6-12/h2-9H,1H3
InChI key:InChIKey=BDYHHBOQBZEHLL-UHFFFAOYSA-N
SMILES:CC=1N(C=2C(N1)=CC(Cl)=CC2)C3=CC=CC=C3
Synonyms:- 5-Chloro-2-methyl-1-phenyl-1H-benzimidazole
- 5-chloro-2-methyl-1-phenyl-benzoimidazole
- Benzimidazole, 5-chloro-2-methyl-1-phenyl-
- NSC 97074
- 1H-Benzimidazole, 5-chloro-2-methyl-1-phenyl-
- 5-chloro-2-methyl-1-phenylbenzimidazole
- 5-chloro-2-methyl-1-phenyl-1H-benzimidazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
