CAS 84102-77-2
:Methyl 5-cyano-2-benzofurancarboxylate
Description:
Methyl 5-cyano-2-benzofurancarboxylate is an organic compound characterized by its unique structure, which includes a benzofuran ring fused with a cyano group and a carboxylate ester functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and conditions. It is known for its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to the reactivity of the cyano and ester groups. The presence of the cyano group can enhance its ability to participate in nucleophilic reactions, making it a valuable intermediate in various chemical transformations. Additionally, the compound may exhibit specific physical properties such as solubility in organic solvents and varying melting and boiling points, which are influenced by its molecular interactions. Safety data should be consulted, as with any chemical, to understand its handling, storage, and potential hazards. Overall, Methyl 5-cyano-2-benzofurancarboxylate is a compound of interest in synthetic organic chemistry.
Formula:C11H7NO3
InChI:InChI=1S/C11H7NO3/c1-14-11(13)10-5-8-4-7(6-12)2-3-9(8)15-10/h2-5H,1H3
InChI key:InChIKey=JHRYAFRCGFDTSK-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC=2C(O1)=CC=C(C#N)C2
Synonyms:- Methyl 5-cyano-2-benzofurancarboxylate
- 2-Benzofurancarboxylic acid, 5-cyano-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
