CymitQuimica logo

CAS 84110-44-1

:

2,4,6-Trimethyl-4-nonanol

Description:
2,4,6-Trimethyl-4-nonanol is an organic compound classified as an alcohol, characterized by its branched structure and the presence of a hydroxyl (-OH) functional group. It features a nonane backbone with three methyl groups located at the 2, 4, and 6 positions, contributing to its unique properties. This compound is typically a colorless liquid with a mild, pleasant odor, making it suitable for use in various applications, including as a fragrance or flavoring agent. Its molecular structure imparts moderate solubility in water, while it is more soluble in organic solvents. 2,4,6-Trimethyl-4-nonanol exhibits typical alcohol characteristics, such as the ability to participate in hydrogen bonding, which influences its boiling point and volatility. Additionally, it may undergo typical reactions associated with alcohols, including oxidation and esterification. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, 2,4,6-Trimethyl-4-nonanol is notable for its structural features and potential applications in the chemical industry.
Formula:C12H26O
InChI:InChI=1S/C12H26O/c1-6-7-11(4)9-12(5,13)8-10(2)3/h10-11,13H,6-9H2,1-5H3
InChI key:InChIKey=RTGWCORQKNEYIB-UHFFFAOYSA-N
SMILES:C(CC(CCC)C)(CC(C)C)(C)O
Synonyms:
  • 4-Nonanol, 2,4,6-trimethyl-
  • 2,4,6-Trimethyl-4-nonanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.