CAS 841222-62-6

4-methyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid

Description:

4-Methyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid is an organic compound characterized by its unique bicyclic structure, which incorporates both a thieno and pyrrole moiety. This compound features a carboxylic acid functional group, contributing to its acidic properties and potential reactivity in various chemical reactions. The presence of the methyl group enhances its solubility and may influence its electronic properties, making it of interest in materials science and organic electronics. The thieno and pyrrole rings provide a conjugated system that can facilitate electron delocalization, which is beneficial for applications in organic semiconductors and photovoltaic devices. Additionally, the compound's structural features may impart specific biological activities, making it a candidate for further investigation in medicinal chemistry. Its CAS number, 841222-62-6, allows for easy identification in chemical databases, facilitating research and development in both academic and industrial settings. Overall, 4-methyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid is a compound of interest due to its unique structure and potential applications in various fields.

Formula: C₈H₇NO₂S

InChI: InChI=1/C8H7NO2S/c1-9-5-2-3-12-7(5)4-6(9)8(10)11/h2-4H,1H3,(H,10,11)

SMILES: Cn1c2ccsc2cc1C(=O)O

4-Methyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid

CAS: 841222-62-6

4-Methyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid

Purity: 97%

Molecular weight: 181.21g/mol

Ref: 54-OR6747

4-methyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid

CAS: 841222-62-6

Formula: C₈H₇NO₂S

Purity: 95.0%

Molecular weight: 181.21

Ref: 10-F523487