CAS 84126-69-2
:ethyl 2-(cyclopentylamino)acetate hydrochloride
Description:
Ethyl 2-(cyclopentylamino)acetate hydrochloride is a chemical compound characterized by its structural features, which include an ethyl ester group and a cyclopentylamino moiety. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it versatile for different applications in organic synthesis and pharmaceutical research. The presence of the hydrochloride salt form enhances its stability and solubility, which is beneficial for biological assays and drug formulation. Ethyl 2-(cyclopentylamino)acetate hydrochloride may exhibit biological activity due to the amino group, which can participate in various interactions with biological targets. Its molecular structure suggests potential uses in medicinal chemistry, particularly in the development of compounds with neuroactive properties. As with many chemical substances, handling should be conducted with care, following appropriate safety protocols to mitigate any risks associated with its use.
Formula:C9H18ClNO2
InChI:InChI=1/C9H17NO2.ClH/c1-2-12-9(11)7-10-8-5-3-4-6-8;/h8,10H,2-7H2,1H3;1H
SMILES:CCOC(=O)CNC1CCCC1.Cl
Synonyms:- Ethyl N-cyclopentylglycinate hydrochloride (1:1)
- Glycine, N-cyclopentyl-, ethyl ester, hydrochloride (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Ethyl 2-(cyclopentylamino)acetate hydrochloride
CAS:Ethyl 2-(cyclopentylamino)acetate hydrochloride
Molecular weight:207.69772g/molN-Cyclopentyl-amino-acetic acid ethyl ester hydrochloride
CAS:Purity:98.0%Color and Shape:Solid, CrystallineMolecular weight:207.6999969482422N-Cyclopentyl-amino-acetic acid ethyl ester HCl
CAS:N-Cyclopentyl-amino-acetic acid ethyl ester HCl is a prophylactic antiviral drug that blocks the synthesis of viral nucleic acids. It prevents the phosphoramidate from binding to the enzyme, preventing production of the antiviral nucleoside. N-Cyclopentyl-amino-acetic acid ethyl ester HCl is used for the treatment and prophylaxis of hepatitis B virus infections. The drug does not inhibit any other type of viral or cellular RNA synthesis, but it inhibits all types of DNA synthesis in cells infected with hepatitis.Formula:C9H18ClNO2Purity:Min. 95%Molecular weight:207.7 g/mol



