CymitQuimica logo

CAS 841274-03-1

:

2,6-Piperazinedione, 1-cyclopropyl-

Description:
2,6-Piperazinedione, 1-cyclopropyl- is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms at positions 1 and 4. The presence of the cyclopropyl group at the 1-position introduces unique steric and electronic properties, potentially influencing its reactivity and biological activity. This compound is typically classified as a cyclic urea derivative, which may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its structure allows for potential interactions with biological targets, and it may be investigated for applications in drug development. The compound's solubility, stability, and reactivity can vary based on its substituents and the surrounding environment. As with many piperazine derivatives, it may also exhibit diverse biological activities, including antimicrobial or antitumor effects. Safety and handling precautions should be observed, as with all chemical substances, particularly in laboratory settings. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C7H10N2O2
InChI:InChI=1S/C7H10N2O2/c10-6-3-8-4-7(11)9(6)5-1-2-5/h5,8H,1-4H2
InChI key:InChIKey=XHHWVFALQDJNCC-UHFFFAOYSA-N
SMILES:O=C1N(C(=O)CNC1)C2CC2
Synonyms:
  • 2,6-Piperazinedione, 1-cyclopropyl-
  • 1-Cyclopropylpiperazine-2,6-dione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.