CymitQuimica logo

CAS 841297-69-6

:

2-phenylquinoline-7-carboxylic acid

Description:
2-Phenylquinoline-7-carboxylic acid is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. This compound features a carboxylic acid functional group at the 7-position and a phenyl group at the 2-position of the quinoline ring. It typically appears as a solid at room temperature and is soluble in organic solvents, with limited solubility in water due to its hydrophobic nature. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, 2-phenylquinoline-7-carboxylic acid may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its unique structure allows for potential interactions with biological targets, which can be explored for therapeutic applications. As with many organic compounds, proper handling and storage are essential to maintain its stability and prevent degradation.
Formula:C16H11NO2
InChI:InChI=1/C16H11NO2/c18-16(19)13-7-6-12-8-9-14(17-15(12)10-13)11-4-2-1-3-5-11/h1-10H,(H,18,19)
SMILES:c1ccc(cc1)c1ccc2ccc(cc2n1)C(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.