CAS 84145-00-6

[1,1′-Biphenyl]-3-carboxylic acid, 2′,4′-difluoro-4-hydroxy-, sodium salt (1:1)

Description:

[1,1′-Biphenyl]-3-carboxylic acid, 2′,4′-difluoro-4-hydroxy-, sodium salt (1:1), commonly referred to as a sodium salt of a biphenyl derivative, exhibits several notable characteristics. This compound features a biphenyl structure with a carboxylic acid functional group and additional fluorine and hydroxy substituents, which can influence its chemical reactivity and solubility. The presence of the sodium salt form suggests enhanced solubility in polar solvents, making it useful in various applications, including pharmaceuticals and agrochemicals. The difluoro and hydroxy groups can impart unique properties, such as increased lipophilicity or altered biological activity. Additionally, the compound may exhibit specific interactions with biological targets due to its functional groups, which can be relevant in medicinal chemistry. Its molecular structure allows for potential applications in organic synthesis and as a building block in the development of more complex chemical entities. Overall, this compound's characteristics are defined by its functional groups, solubility, and potential reactivity, making it a subject of interest in various chemical research fields.

Formula: C₁₃H₇F₂NaO₃

InChI: InChI=1/C13H8F2O3.Na/c14-8-2-3-9(11(15)6-8)7-1-4-12(16)10(5-7)13(17)18;/h1-6,16H,(H,17,18);/q;+1/p-1

InChI key: InChIKey=CGZRRHAQFABLPW-UHFFFAOYSA-N

SMILES: FC1=C(C=CC(F)=C1)C2=CC(C(O)=O)=C(O)C=C2.[Na]

Synonyms:

• Diflunisal sodium
• Sodium 2',4'-Difluoro-4-Hydroxybiphenyl-3-Carboxylate
• Sodium diflunisal
• [1,1′-Biphenyl]-3-carboxylic acid, 2′,4′-difluoro-4-hydroxy-, monosodium salt
• [1,1′-Biphenyl]-3-carboxylic acid, 2′,4′-difluoro-4-hydroxy-, sodium salt (1:1)
• Sodium 2',4'-difluoro-4-hydroxy(1,1'-biphenyl)-3-carboxylate