CAS 84145-40-4

N-Ethyl-6-methyl-3-pyridineethanamine

Description:

N-Ethyl-6-methyl-3-pyridineethanamine, with the CAS number 84145-40-4, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an ethyl group and a methyl group attached to the pyridine ring, contributing to its unique chemical properties. It is classified as an amine due to the presence of an amino group (-NH2) linked to the ethyl chain. The presence of the nitrogen atom in the pyridine ring and the amino group suggests that this compound may exhibit basic properties and can participate in hydrogen bonding. N-Ethyl-6-methyl-3-pyridineethanamine may be of interest in various fields, including medicinal chemistry and organic synthesis, due to its potential biological activity and ability to act as a ligand in coordination chemistry. Its solubility, stability, and reactivity would depend on the specific conditions, such as pH and temperature, as well as the presence of other functional groups in a given reaction environment.

Formula: C₁₀H₁₆N₂

InChI: InChI=1S/C10H16N2/c1-3-11-7-6-10-5-4-9(2)12-8-10/h4-5,8,11H,3,6-7H2,1-2H3

InChI key: InChIKey=ZCHKCLFAOKZPPY-UHFFFAOYSA-N

SMILES: C(CNCC)C=1C=CC(C)=NC1

Synonyms:

• 2-Picoline, 5-[2-(ethylamino)ethyl]-
• 3-Pyridineethanamine, N-ethyl-6-methyl-
• N-Ethyl-6-methyl-3-pyridineethanamine