CAS 84145-68-6
:3-[(4-Chloro-2-nitrophenyl)amino]-1-propanol
Description:
3-[(4-Chloro-2-nitrophenyl)amino]-1-propanol, identified by its CAS number 84145-68-6, is an organic compound characterized by the presence of both an amino group and a hydroxyl group, making it an amino alcohol. This compound features a propanol backbone with a chloro and nitro substituent on the aromatic ring, which contributes to its chemical reactivity and potential biological activity. The presence of the chloro group can enhance lipophilicity, while the nitro group may impart specific electronic properties that influence its interactions in biological systems. Typically, compounds of this nature may exhibit various pharmacological properties, including antimicrobial or anti-inflammatory activities, although specific biological effects would depend on further empirical studies. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present, making it of interest in medicinal chemistry and material science. Safety and handling precautions should be observed due to the presence of halogen and nitro groups, which can pose health risks.
Formula:C9H11ClN2O3
InChI:InChI=1S/C9H11ClN2O3/c10-7-2-3-8(11-4-1-5-13)9(6-7)12(14)15/h2-3,6,11,13H,1,4-5H2
InChI key:InChIKey=JHJLKWHUMFLDJE-UHFFFAOYSA-N
SMILES:N(CCCO)C1=C(N(=O)=O)C=C(Cl)C=C1
Synonyms:- 1-Propanol, 3-[(4-chloro-2-nitrophenyl)amino]-
- 3-((4-Chloro-2-nitrophenyl)amino)propan-1-ol
- 4-Chloro-N-(3-hydroxypropyl)-2-nitroaniline
- 3-[(4-Chloro-2-nitrophenyl)amino]-1-propanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Chloro-N-(3-hydroxypropyl)-2-nitroaniline
CAS:Controlled ProductFormula:C9H11ClN2O3Color and Shape:NeatMolecular weight:230.648
